C13H13N5O2 — CID 161123318
2H-benzotriazole;3,5-diaminobenzoic acid (PubChem CID 161123318) has the molecular formula C13H13N5O2 and a molecular weight of 271.28 g/mol. Its IUPAC name is 2H-benzotriazole;3,5-diaminobenzoic acid.
| Compound Name | 2H-benzotriazole;3,5-diaminobenzoic acid |
|---|---|
| PubChem CID | 161123318 |
| Molecular Formula | C13H13N5O2 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.11 |
| IUPAC Name | 2H-benzotriazole;3,5-diaminobenzoic acid |
| SMILES | Nc1cc(N)cc(C(=O)O)c1.c1ccc2n[nH]nc2c1 |
| InChI | InChI=1S/C7H8N2O2.C6H5N3/c8-5-1-4(7(10)11)2-6(9)3-5;1-2-4-6-5(3-1)7-9-8-6/h1-3H,8-9H2,(H,10,11);1-4H,(H,7,8,9) |
| InChIKey | ULFRCHSQZHIDIG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 130.91 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|