C29H52N4 — CID 141237856
5-[[3,4-bis(butan-2-ylamino)-3,5-diethylcyclohexa-1,5-dien-1-yl]methyl]-1,3-diethylcyclohexa-3,5-diene-1,2-diamine (PubChem CID 141237856) has the molecular formula C29H52N4 and a molecular weight of 456.76 g/mol. Its IUPAC name is 5-[[3,4-bis(butan-2-ylamino)-3,5-diethylcyclohexa-1,5-dien-1-yl]methyl]-1,3-diethylcyclohexa-3,5-diene-1,2-diamine.
| Compound Name | 5-[[3,4-bis(butan-2-ylamino)-3,5-diethylcyclohexa-1,5-dien-1-yl]methyl]-1,3-diethylcyclohexa-3,5-diene-1,2-diamine |
|---|---|
| PubChem CID | 141237856 |
| Molecular Formula | C29H52N4 |
| Molecular Weight | 456.76 g/mol |
| Exact Mass | 456.42 |
| IUPAC Name | 5-[[3,4-bis(butan-2-ylamino)-3,5-diethylcyclohexa-1,5-dien-1-yl]methyl]-1,3-diethylcyclohexa-3,5-diene-1,2-diamine |
| SMILES | CCC1=CC(CC2=CC(CC)(NC(C)CC)C(NC(C)CC)C(CC)=C2)=CC(N)(CC)C1N |
| InChI | InChI=1S/C29H52N4/c1-9-20(7)32-27-25(12-4)17-23(19-29(27,14-6)33-21(8)10-2)15-22-16-24(11-3)26(30)28(31,13-5)18-22/h16-21,26-27,32-33H,9-15,30-31H2,1-8H3 |
| InChIKey | OVYVXWHPNLEURP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 76.10 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.76 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |