C21H31N5 — CID 141237974
6-methyl-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-phenylpyrimidine-2,4-diamine (PubChem CID 141237974) has the molecular formula C21H31N5 and a molecular weight of 353.51 g/mol. Its IUPAC name is 6-methyl-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-phenylpyrimidine-2,4-diamine.
| Compound Name | 6-methyl-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-phenylpyrimidine-2,4-diamine |
|---|---|
| PubChem CID | 141237974 |
| Molecular Formula | C21H31N5 |
| Molecular Weight | 353.51 g/mol |
| Exact Mass | 353.26 |
| IUPAC Name | 6-methyl-4-N-(1,2,2,6,6-pentamethylpiperidin-4-yl)-5-phenylpyrimidine-2,4-diamine |
| SMILES | Cc1nc(N)nc(NC2CC(C)(C)N(C)C(C)(C)C2)c1-c1ccccc1 |
| InChI | InChI=1S/C21H31N5/c1-14-17(15-10-8-7-9-11-15)18(25-19(22)23-14)24-16-12-20(2,3)26(6)21(4,5)13-16/h7-11,16H,12-13H2,1-6H3,(H3,22,23,24,25) |
| InChIKey | SHFHTYNISJBOBW-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 67.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.51 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |