C17H14F2O3 — CID 141250021
(2-butanoyl-4,6-difluorophenyl) benzoate (PubChem CID 141250021) has the molecular formula C17H14F2O3 and a molecular weight of 304.29 g/mol. Its IUPAC name is (2-butanoyl-4,6-difluorophenyl) benzoate.
| Compound Name | (2-butanoyl-4,6-difluorophenyl) benzoate |
|---|---|
| PubChem CID | 141250021 |
| Molecular Formula | C17H14F2O3 |
| Molecular Weight | 304.29 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | (2-butanoyl-4,6-difluorophenyl) benzoate |
| SMILES | CCCC(=O)c1cc(F)cc(F)c1OC(=O)c1ccccc1 |
| InChI | InChI=1S/C17H14F2O3/c1-2-6-15(20)13-9-12(18)10-14(19)16(13)22-17(21)11-7-4-3-5-8-11/h3-5,7-10H,2,6H2,1H3 |
| InChIKey | RMERVHSHXUUADV-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.29 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|