C25H30F2N2O8 — CID 141270948
[2-(5-acetyloxy-2-aminocyclohexyl)-4-(2,2-difluoroethoxy)-5-methoxyphenyl] 2,6-dimethoxypyridine-4-carboxylate (PubChem CID 141270948) has the molecular formula C25H30F2N2O8 and a molecular weight of 524.52 g/mol. Its IUPAC name is [2-(5-acetyloxy-2-aminocyclohexyl)-4-(2,2-difluoroethoxy)-5-methoxyphenyl] 2,6-dimethoxypyridine-4-carboxylate.
| Compound Name | [2-(5-acetyloxy-2-aminocyclohexyl)-4-(2,2-difluoroethoxy)-5-methoxyphenyl] 2,6-dimethoxypyridine-4-carboxylate |
|---|---|
| PubChem CID | 141270948 |
| Molecular Formula | C25H30F2N2O8 |
| Molecular Weight | 524.52 g/mol |
| Exact Mass | 524.20 |
| IUPAC Name | [2-(5-acetyloxy-2-aminocyclohexyl)-4-(2,2-difluoroethoxy)-5-methoxyphenyl] 2,6-dimethoxypyridine-4-carboxylate |
| SMILES | COc1cc(C(=O)Oc2cc(OC)c(OCC(F)F)cc2C2CC(OC(C)=O)CCC2N)cc(OC)n1 |
| InChI | InChI=1S/C25H30F2N2O8/c1-13(30)36-15-5-6-18(28)16(9-15)17-10-21(35-12-22(26)27)20(32-2)11-19(17)37-25(31)14-7-23(33-3)29-24(8-14)34-4/h7-8,10-11,15-16,18,22H,5-6,9,12,28H2,1-4H3 |
| InChIKey | LORWAMINEWJLMS-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 128.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|