C18H8Br2N2 — CID 141295302
9,14-dibromo-4,7-diazapentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3,5,7,9,12(20),13,15,17-decaene (PubChem CID 141295302) has the molecular formula C18H8Br2N2 and a molecular weight of 412.08 g/mol. Its IUPAC name is 9,14-dibromo-4,7-diazapentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3,5,7,9,12(20),13,15,17-decaene.
| Compound Name | 9,14-dibromo-4,7-diazapentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3,5,7,9,12(20),13,15,17-decaene |
|---|---|
| PubChem CID | 141295302 |
| Molecular Formula | C18H8Br2N2 |
| Molecular Weight | 412.08 g/mol |
| Exact Mass | 409.91 |
| IUPAC Name | 9,14-dibromo-4,7-diazapentacyclo[10.7.1.02,11.03,8.016,20]icosa-1(19),2(11),3,5,7,9,12(20),13,15,17-decaene |
| SMILES | Brc1cc2c3c(cccc3c1)-c1c-2cc(Br)c2nccnc12 |
| InChI | InChI=1S/C18H8Br2N2/c19-10-6-9-2-1-3-11-15(9)12(7-10)13-8-14(20)17-18(16(11)13)22-5-4-21-17/h1-8H |
| InChIKey | DXKCRLUOJBGXQD-UHFFFAOYSA-N |
| XLogP | 5.96 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.08 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |