C15H7Br4NO — CID 166440517
2,4,6-tribromo-3-(6-bromoquinolin-8-yl)phenol (PubChem CID 166440517) has the molecular formula C15H7Br4NO and a molecular weight of 536.84 g/mol. Its IUPAC name is 2,4,6-tribromo-3-(6-bromoquinolin-8-yl)phenol.
| Compound Name | 2,4,6-tribromo-3-(6-bromoquinolin-8-yl)phenol |
|---|---|
| PubChem CID | 166440517 |
| Molecular Formula | C15H7Br4NO |
| Molecular Weight | 536.84 g/mol |
| Exact Mass | 532.73 |
| IUPAC Name | 2,4,6-tribromo-3-(6-bromoquinolin-8-yl)phenol |
| SMILES | Oc1c(Br)cc(Br)c(-c2cc(Br)cc3cccnc23)c1Br |
| InChI | InChI=1S/C15H7Br4NO/c16-8-4-7-2-1-3-20-14(7)9(5-8)12-10(17)6-11(18)15(21)13(12)19/h1-6,21H |
| InChIKey | WHHMYSMTQFSWRF-UHFFFAOYSA-N |
| XLogP | 6.66 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.84 |
| LogP ≤ 5 | 6.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |