About 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one
5,7-dibromoquinolin-8-ol;1H-quinolin-2-one (PubChem CID 158836094) has the molecular formula C18H12Br2N2O2
and a molecular weight of 448.11 g/mol. Its IUPAC name is 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one.
Molecular Properties
| Compound Name | 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one |
| PubChem CID | 158836094 |
| Molecular Formula | C18H12Br2N2O2 |
| Molecular Weight | 448.11 g/mol |
| Exact Mass | 445.93 |
| IUPAC Name | 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one |
| SMILES | O=c1ccc2ccccc2[nH]1.Oc1c(Br)cc(Br)c2cccnc12 |
| InChI | InChI=1S/C9H5Br2NO.C9H7NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;11-9-6-5-7-3-1-2-4-8(7)10-9/h1-4,13H;1-6H,(H,10,11) |
| InChIKey | IXQRQKZEQYWOEO-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 448.11 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one?
The IUPAC name of 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one (CID 158836094) is 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one.
What is the SMILES notation for 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one?
The canonical SMILES for 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one is O=c1ccc2ccccc2[nH]1.Oc1c(Br)cc(Br)c2cccnc12.
What is the InChIKey of 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one?
The InChIKey is IXQRQKZEQYWOEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H5Br2NO.C9H7NO/c10-6-4-7(11)9(13)8-5(6)2-1-3-12-8;11-9-6-5-7-3-1-2-4-8(7)10-9/h1-4,13H;1-6H,(H,10,11).
What are the key properties of 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one?
5,7-dibromoquinolin-8-ol;1H-quinolin-2-one has a molecular weight of 448.11 g/mol, XLogP of 4.99, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5,7-dibromoquinolin-8-ol;1H-quinolin-2-one is sourced from PubChem (CID 158836094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).