About 2-aminoacetic acid;1H-quinolin-2-one
2-aminoacetic acid;1H-quinolin-2-one (PubChem CID 159271091) has the molecular formula C11H12N2O3
and a molecular weight of 220.23 g/mol. Its IUPAC name is 2-aminoacetic acid;1H-quinolin-2-one.
Molecular Properties
| Compound Name | 2-aminoacetic acid;1H-quinolin-2-one |
| PubChem CID | 159271091 |
| Molecular Formula | C11H12N2O3 |
| Molecular Weight | 220.23 g/mol |
| Exact Mass | 220.08 |
| IUPAC Name | 2-aminoacetic acid;1H-quinolin-2-one |
| SMILES | NCC(=O)O.O=c1ccc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H7NO.C2H5NO2/c11-9-6-5-7-3-1-2-4-8(7)10-9;3-1-2(4)5/h1-6H,(H,10,11);1,3H2,(H,4,5) |
| InChIKey | KXSMJTWUFKSVLV-UHFFFAOYSA-N |
| XLogP | 0.56 |
| TPSA | 96.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.23 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-aminoacetic acid;1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminoacetic acid;1H-quinolin-2-one?
The IUPAC name of 2-aminoacetic acid;1H-quinolin-2-one (CID 159271091) is 2-aminoacetic acid;1H-quinolin-2-one.
What is the SMILES notation for 2-aminoacetic acid;1H-quinolin-2-one?
The canonical SMILES for 2-aminoacetic acid;1H-quinolin-2-one is NCC(=O)O.O=c1ccc2ccccc2[nH]1.
What is the InChIKey of 2-aminoacetic acid;1H-quinolin-2-one?
The InChIKey is KXSMJTWUFKSVLV-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C2H5NO2/c11-9-6-5-7-3-1-2-4-8(7)10-9;3-1-2(4)5/h1-6H,(H,10,11);1,3H2,(H,4,5).
What are the key properties of 2-aminoacetic acid;1H-quinolin-2-one?
2-aminoacetic acid;1H-quinolin-2-one has a molecular weight of 220.23 g/mol, XLogP of 0.56, 1 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminoacetic acid;1H-quinolin-2-one is sourced from PubChem (CID 159271091), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).