About hydrazine;1H-quinolin-2-one
hydrazine;1H-quinolin-2-one (PubChem CID 157180038) has the molecular formula C9H11N3O
and a molecular weight of 177.21 g/mol. Its IUPAC name is hydrazine;1H-quinolin-2-one.
Molecular Properties
| Compound Name | hydrazine;1H-quinolin-2-one |
| PubChem CID | 157180038 |
| Molecular Formula | C9H11N3O |
| Molecular Weight | 177.21 g/mol |
| Exact Mass | 177.09 |
| IUPAC Name | hydrazine;1H-quinolin-2-one |
| SMILES | NN.O=c1ccc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H7NO.H4N2/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2/h1-6H,(H,10,11);1-2H2 |
| InChIKey | AOLUDHCLOFYLDR-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 84.90 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.21 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze hydrazine;1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydrazine;1H-quinolin-2-one?
The IUPAC name of hydrazine;1H-quinolin-2-one (CID 157180038) is hydrazine;1H-quinolin-2-one.
What is the SMILES notation for hydrazine;1H-quinolin-2-one?
The canonical SMILES for hydrazine;1H-quinolin-2-one is NN.O=c1ccc2ccccc2[nH]1.
What is the InChIKey of hydrazine;1H-quinolin-2-one?
The InChIKey is AOLUDHCLOFYLDR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.H4N2/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2/h1-6H,(H,10,11);1-2H2.
What are the key properties of hydrazine;1H-quinolin-2-one?
hydrazine;1H-quinolin-2-one has a molecular weight of 177.21 g/mol, XLogP of 0.35, 0 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hydrazine;1H-quinolin-2-one is sourced from PubChem (CID 157180038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).