About 2-ethyl-1H-azepine;1H-quinolin-2-one
2-ethyl-1H-azepine;1H-quinolin-2-one (PubChem CID 174887038) has the molecular formula C17H18N2O
and a molecular weight of 266.34 g/mol. Its IUPAC name is 2-ethyl-1H-azepine;1H-quinolin-2-one.
Molecular Properties
| Compound Name | 2-ethyl-1H-azepine;1H-quinolin-2-one |
| PubChem CID | 174887038 |
| Molecular Formula | C17H18N2O |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.14 |
| IUPAC Name | 2-ethyl-1H-azepine;1H-quinolin-2-one |
| SMILES | CCC1=CC=CC=CN1.O=c1ccc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H7NO.C8H11N/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2-8-6-4-3-5-7-9-8/h1-6H,(H,10,11);3-7,9H,2H2,1H3 |
| InChIKey | HQWFEDVGLDLUDH-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 44.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-ethyl-1H-azepine;1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-1H-azepine;1H-quinolin-2-one?
The IUPAC name of 2-ethyl-1H-azepine;1H-quinolin-2-one (CID 174887038) is 2-ethyl-1H-azepine;1H-quinolin-2-one.
What is the SMILES notation for 2-ethyl-1H-azepine;1H-quinolin-2-one?
The canonical SMILES for 2-ethyl-1H-azepine;1H-quinolin-2-one is CCC1=CC=CC=CN1.O=c1ccc2ccccc2[nH]1.
What is the InChIKey of 2-ethyl-1H-azepine;1H-quinolin-2-one?
The InChIKey is HQWFEDVGLDLUDH-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C8H11N/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-2-8-6-4-3-5-7-9-8/h1-6H,(H,10,11);3-7,9H,2H2,1H3.
What are the key properties of 2-ethyl-1H-azepine;1H-quinolin-2-one?
2-ethyl-1H-azepine;1H-quinolin-2-one has a molecular weight of 266.34 g/mol, XLogP of 3.48, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-1H-azepine;1H-quinolin-2-one is sourced from PubChem (CID 174887038), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).