About molecular hydrogen;propane;1H-quinolin-2-one
molecular hydrogen;propane;1H-quinolin-2-one (PubChem CID 142067755) has the molecular formula C12H17NO
and a molecular weight of 191.27 g/mol. Its IUPAC name is molecular hydrogen;propane;1H-quinolin-2-one.
Molecular Properties
| Compound Name | molecular hydrogen;propane;1H-quinolin-2-one |
| PubChem CID | 142067755 |
| Molecular Formula | C12H17NO |
| Molecular Weight | 191.27 g/mol |
| Exact Mass | 191.13 |
| IUPAC Name | molecular hydrogen;propane;1H-quinolin-2-one |
| SMILES | CCC.O=c1ccc2ccccc2[nH]1.[H][H] |
| InChI | InChI=1S/C9H7NO.C3H8.H2/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-3-2;/h1-6H,(H,10,11);3H2,1-2H3;1H |
| InChIKey | JRRIGOBCQOMZEF-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 191.27 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze molecular hydrogen;propane;1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of molecular hydrogen;propane;1H-quinolin-2-one?
The IUPAC name of molecular hydrogen;propane;1H-quinolin-2-one (CID 142067755) is molecular hydrogen;propane;1H-quinolin-2-one.
What is the SMILES notation for molecular hydrogen;propane;1H-quinolin-2-one?
The canonical SMILES for molecular hydrogen;propane;1H-quinolin-2-one is CCC.O=c1ccc2ccccc2[nH]1.[H][H].
What is the InChIKey of molecular hydrogen;propane;1H-quinolin-2-one?
The InChIKey is JRRIGOBCQOMZEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.C3H8.H2/c11-9-6-5-7-3-1-2-4-8(7)10-9;1-3-2;/h1-6H,(H,10,11);3H2,1-2H3;1H.
What are the key properties of molecular hydrogen;propane;1H-quinolin-2-one?
molecular hydrogen;propane;1H-quinolin-2-one has a molecular weight of 191.27 g/mol, XLogP of 3.19, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for molecular hydrogen;propane;1H-quinolin-2-one is sourced from PubChem (CID 142067755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).