About isocyanic acid;1H-quinolin-2-one
isocyanic acid;1H-quinolin-2-one (PubChem CID 176531100) has the molecular formula C10H8N2O2
and a molecular weight of 188.19 g/mol. Its IUPAC name is isocyanic acid;1H-quinolin-2-one.
Molecular Properties
| Compound Name | isocyanic acid;1H-quinolin-2-one |
| PubChem CID | 176531100 |
| Molecular Formula | C10H8N2O2 |
| Molecular Weight | 188.19 g/mol |
| Exact Mass | 188.06 |
| IUPAC Name | isocyanic acid;1H-quinolin-2-one |
| SMILES | N=C=O.O=c1ccc2ccccc2[nH]1 |
| InChI | InChI=1S/C9H7NO.CHNO/c11-9-6-5-7-3-1-2-4-8(7)10-9;2-1-3/h1-6H,(H,10,11);2H |
| InChIKey | AYINPNQEJHVPNI-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 73.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.19 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze isocyanic acid;1H-quinolin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of isocyanic acid;1H-quinolin-2-one?
The IUPAC name of isocyanic acid;1H-quinolin-2-one (CID 176531100) is isocyanic acid;1H-quinolin-2-one.
What is the SMILES notation for isocyanic acid;1H-quinolin-2-one?
The canonical SMILES for isocyanic acid;1H-quinolin-2-one is N=C=O.O=c1ccc2ccccc2[nH]1.
What is the InChIKey of isocyanic acid;1H-quinolin-2-one?
The InChIKey is AYINPNQEJHVPNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7NO.CHNO/c11-9-6-5-7-3-1-2-4-8(7)10-9;2-1-3/h1-6H,(H,10,11);2H.
What are the key properties of isocyanic acid;1H-quinolin-2-one?
isocyanic acid;1H-quinolin-2-one has a molecular weight of 188.19 g/mol, XLogP of 1.43, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for isocyanic acid;1H-quinolin-2-one is sourced from PubChem (CID 176531100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).