C9H5ClN4O5 — CID 141297904
N-[chloro(cyano)methyl]-3,5-dinitrobenzamide (PubChem CID 141297904) has the molecular formula C9H5ClN4O5 and a molecular weight of 284.62 g/mol. Its IUPAC name is N-[chloro(cyano)methyl]-3,5-dinitrobenzamide.
| Compound Name | N-[chloro(cyano)methyl]-3,5-dinitrobenzamide |
|---|---|
| PubChem CID | 141297904 |
| Molecular Formula | C9H5ClN4O5 |
| Molecular Weight | 284.62 g/mol |
| Exact Mass | 283.99 |
| IUPAC Name | N-[chloro(cyano)methyl]-3,5-dinitrobenzamide |
| SMILES | N#CC(Cl)NC(=O)c1cc([N+](=O)[O-])cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H5ClN4O5/c10-8(4-11)12-9(15)5-1-6(13(16)17)3-7(2-5)14(18)19/h1-3,8H,(H,12,15) |
| InChIKey | ZHOIOIDNUFTMOT-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 139.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.62 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|