C9H11N3 — CID 141304061
4-phenyl-5,6-dihydro-1H-1,2,4-triazine (PubChem CID 141304061) has the molecular formula C9H11N3 and a molecular weight of 161.21 g/mol. Its IUPAC name is 4-phenyl-5,6-dihydro-1H-1,2,4-triazine.
| Compound Name | 4-phenyl-5,6-dihydro-1H-1,2,4-triazine |
|---|---|
| PubChem CID | 141304061 |
| Molecular Formula | C9H11N3 |
| Molecular Weight | 161.21 g/mol |
| Exact Mass | 161.10 |
| IUPAC Name | 4-phenyl-5,6-dihydro-1H-1,2,4-triazine |
| SMILES | C1=NNCCN1c1ccccc1 |
| InChI | InChI=1S/C9H11N3/c1-2-4-9(5-3-1)12-7-6-10-11-8-12/h1-5,8,10H,6-7H2 |
| InChIKey | MSNOQJLKTAXOSE-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.21 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |