C22H26N4O4 — CID 141319994
tert-butyl N-[2-[[2-(hydrazinecarbonyl)-7-phenyl-1H-indol-4-yl]oxy]ethyl]carbamate (PubChem CID 141319994) has the molecular formula C22H26N4O4 and a molecular weight of 410.47 g/mol. Its IUPAC name is tert-butyl N-[2-[[2-(hydrazinecarbonyl)-7-phenyl-1H-indol-4-yl]oxy]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[2-(hydrazinecarbonyl)-7-phenyl-1H-indol-4-yl]oxy]ethyl]carbamate |
|---|---|
| PubChem CID | 141319994 |
| Molecular Formula | C22H26N4O4 |
| Molecular Weight | 410.47 g/mol |
| Exact Mass | 410.20 |
| IUPAC Name | tert-butyl N-[2-[[2-(hydrazinecarbonyl)-7-phenyl-1H-indol-4-yl]oxy]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCOc1ccc(-c2ccccc2)c2[nH]c(C(=O)NN)cc12 |
| InChI | InChI=1S/C22H26N4O4/c1-22(2,3)30-21(28)24-11-12-29-18-10-9-15(14-7-5-4-6-8-14)19-16(18)13-17(25-19)20(27)26-23/h4-10,13,25H,11-12,23H2,1-3H3,(H,24,28)(H,26,27) |
| InChIKey | BSOLJRGPDXRGPY-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 118.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|