C24H29N3S2 — CID 141326077
5-decyl-4,7-dithiophen-2-yl-2H-benzotriazole (PubChem CID 141326077) has the molecular formula C24H29N3S2 and a molecular weight of 423.65 g/mol. Its IUPAC name is 5-decyl-4,7-dithiophen-2-yl-2H-benzotriazole.
| Compound Name | 5-decyl-4,7-dithiophen-2-yl-2H-benzotriazole |
|---|---|
| PubChem CID | 141326077 |
| Molecular Formula | C24H29N3S2 |
| Molecular Weight | 423.65 g/mol |
| Exact Mass | 423.18 |
| IUPAC Name | 5-decyl-4,7-dithiophen-2-yl-2H-benzotriazole |
| SMILES | CCCCCCCCCCc1cc(-c2cccs2)c2n[nH]nc2c1-c1cccs1 |
| InChI | InChI=1S/C24H29N3S2/c1-2-3-4-5-6-7-8-9-12-18-17-19(20-13-10-15-28-20)23-24(26-27-25-23)22(18)21-14-11-16-29-21/h10-11,13-17H,2-9,12H2,1H3,(H,25,26,27) |
| InChIKey | QRSOCDXIPGPLBA-UHFFFAOYSA-N |
| XLogP | 8.10 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.65 |
| LogP ≤ 5 | 8.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|