C13H24O5Si — CID 141329339
2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-trimethylsilylpentanoate (PubChem CID 141329339) has the molecular formula C13H24O5Si and a molecular weight of 288.42 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-trimethylsilylpentanoate.
| Compound Name | 2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-trimethylsilylpentanoate |
|---|---|
| PubChem CID | 141329339 |
| Molecular Formula | C13H24O5Si |
| Molecular Weight | 288.42 g/mol |
| Exact Mass | 288.14 |
| IUPAC Name | 2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-trimethylsilylpentanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(O)(CO)CCC[Si](C)(C)C |
| InChI | InChI=1S/C13H24O5Si/c1-10(2)11(15)18-12(16)13(17,9-14)7-6-8-19(3,4)5/h14,17H,1,6-9H2,2-5H3 |
| InChIKey | DCQIZOLCQDLBKR-UHFFFAOYSA-N |
| XLogP | 1.47 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.42 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|