C19H42O8Si4 — CID 139715012
2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-tris(trimethylsilyloxy)silylpentanoate (PubChem CID 139715012) has the molecular formula C19H42O8Si4 and a molecular weight of 510.88 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-tris(trimethylsilyloxy)silylpentanoate.
| Compound Name | 2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-tris(trimethylsilyloxy)silylpentanoate |
|---|---|
| PubChem CID | 139715012 |
| Molecular Formula | C19H42O8Si4 |
| Molecular Weight | 510.88 g/mol |
| Exact Mass | 510.20 |
| IUPAC Name | 2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-tris(trimethylsilyloxy)silylpentanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(O)(CO)CCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C19H42O8Si4/c1-16(2)17(21)24-18(22)19(23,15-20)13-12-14-31(25-28(3,4)5,26-29(6,7)8)27-30(9,10)11/h20,23H,1,12-15H2,2-11H3 |
| InChIKey | IPEWFTZAQOQWQF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.88 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|