C17H36O7Si3 — CID 54099461
2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-[methyl-bis(trimethylsilyloxy)silyl]pentanoate (PubChem CID 54099461) has the molecular formula C17H36O7Si3 and a molecular weight of 436.73 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-[methyl-bis(trimethylsilyloxy)silyl]pentanoate.
| Compound Name | 2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-[methyl-bis(trimethylsilyloxy)silyl]pentanoate |
|---|---|
| PubChem CID | 54099461 |
| Molecular Formula | C17H36O7Si3 |
| Molecular Weight | 436.73 g/mol |
| Exact Mass | 436.18 |
| IUPAC Name | 2-methylprop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-[methyl-bis(trimethylsilyloxy)silyl]pentanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(O)(CO)CCC[Si](C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H36O7Si3/c1-14(2)15(19)22-16(20)17(21,13-18)11-10-12-27(9,23-25(3,4)5)24-26(6,7)8/h18,21H,1,10-13H2,2-9H3 |
| InChIKey | MZNJLYDPJUCJBS-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.73 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|