C15H30O6Si2 — CID 139750816
2-methylprop-2-enoyl 5-[dimethyl(trimethylsilyloxy)silyl]-2-hydroxy-2-(hydroxymethyl)pentanoate (PubChem CID 139750816) has the molecular formula C15H30O6Si2 and a molecular weight of 362.57 g/mol. Its IUPAC name is 2-methylprop-2-enoyl 5-[dimethyl(trimethylsilyloxy)silyl]-2-hydroxy-2-(hydroxymethyl)pentanoate.
| Compound Name | 2-methylprop-2-enoyl 5-[dimethyl(trimethylsilyloxy)silyl]-2-hydroxy-2-(hydroxymethyl)pentanoate |
|---|---|
| PubChem CID | 139750816 |
| Molecular Formula | C15H30O6Si2 |
| Molecular Weight | 362.57 g/mol |
| Exact Mass | 362.16 |
| IUPAC Name | 2-methylprop-2-enoyl 5-[dimethyl(trimethylsilyloxy)silyl]-2-hydroxy-2-(hydroxymethyl)pentanoate |
| SMILES | C=C(C)C(=O)OC(=O)C(O)(CO)CCC[Si](C)(C)O[Si](C)(C)C |
| InChI | InChI=1S/C15H30O6Si2/c1-12(2)13(17)20-14(18)15(19,11-16)9-8-10-23(6,7)21-22(3,4)5/h16,19H,1,8-11H2,2-7H3 |
| InChIKey | RVYSOZZLUFYDFK-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.57 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|