C18H40O8Si4 — CID 141090468
prop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-tris(trimethylsilyloxy)silylpentanoate (PubChem CID 141090468) has the molecular formula C18H40O8Si4 and a molecular weight of 496.85 g/mol. Its IUPAC name is prop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-tris(trimethylsilyloxy)silylpentanoate.
| Compound Name | prop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-tris(trimethylsilyloxy)silylpentanoate |
|---|---|
| PubChem CID | 141090468 |
| Molecular Formula | C18H40O8Si4 |
| Molecular Weight | 496.85 g/mol |
| Exact Mass | 496.18 |
| IUPAC Name | prop-2-enoyl 2-hydroxy-2-(hydroxymethyl)-5-tris(trimethylsilyloxy)silylpentanoate |
| SMILES | C=CC(=O)OC(=O)C(O)(CO)CCC[Si](O[Si](C)(C)C)(O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C18H40O8Si4/c1-11-16(20)23-17(21)18(22,15-19)13-12-14-30(24-27(2,3)4,25-28(5,6)7)26-29(8,9)10/h11,19,22H,1,12-15H2,2-10H3 |
| InChIKey | NFXVNGFRVKNLQM-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 111.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.85 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|