C19H25FO — CID 141329838
4-[[3-(4-fluoro-2,6-dimethylphenyl)cyclopentylidene]methyl]oxane (PubChem CID 141329838) has the molecular formula C19H25FO and a molecular weight of 288.41 g/mol. Its IUPAC name is 4-[[3-(4-fluoro-2,6-dimethylphenyl)cyclopentylidene]methyl]oxane.
| Compound Name | 4-[[3-(4-fluoro-2,6-dimethylphenyl)cyclopentylidene]methyl]oxane |
|---|---|
| PubChem CID | 141329838 |
| Molecular Formula | C19H25FO |
| Molecular Weight | 288.41 g/mol |
| Exact Mass | 288.19 |
| IUPAC Name | 4-[[3-(4-fluoro-2,6-dimethylphenyl)cyclopentylidene]methyl]oxane |
| SMILES | Cc1cc(F)cc(C)c1C1CCC(=CC2CCOCC2)C1 |
| InChI | InChI=1S/C19H25FO/c1-13-9-18(20)10-14(2)19(13)17-4-3-16(12-17)11-15-5-7-21-8-6-15/h9-11,15,17H,3-8,12H2,1-2H3 |
| InChIKey | ZMLWCUWHGUALHV-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.41 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|