C35H32BrN3O3 — CID 141332675
N-(4-acetylphenyl)-N-[(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-2-(2-phenylethylamino)acetamide (PubChem CID 141332675) has the molecular formula C35H32BrN3O3 and a molecular weight of 622.56 g/mol. Its IUPAC name is N-(4-acetylphenyl)-N-[(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-2-(2-phenylethylamino)acetamide.
| Compound Name | N-(4-acetylphenyl)-N-[(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-2-(2-phenylethylamino)acetamide |
|---|---|
| PubChem CID | 141332675 |
| Molecular Formula | C35H32BrN3O3 |
| Molecular Weight | 622.56 g/mol |
| Exact Mass | 621.16 |
| IUPAC Name | N-(4-acetylphenyl)-N-[(6-bromo-2-methoxyquinolin-3-yl)-phenylmethyl]-2-(2-phenylethylamino)acetamide |
| SMILES | COc1nc2ccc(Br)cc2cc1C(c1ccccc1)N(C(=O)CNCCc1ccccc1)c1ccc(C(C)=O)cc1 |
| InChI | InChI=1S/C35H32BrN3O3/c1-24(40)26-13-16-30(17-14-26)39(33(41)23-37-20-19-25-9-5-3-6-10-25)34(27-11-7-4-8-12-27)31-22-28-21-29(36)15-18-32(28)38-35(31)42-2/h3-18,21-22,34,37H,19-20,23H2,1-2H3 |
| InChIKey | XRQRNGMYTIAUOS-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 71.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.56 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|