C25H30N2O3S — CID 141341768
N-[4-[2-methoxy-3-(1-methoxyheptyl)phenyl]-1,3-thiazol-2-yl]benzamide (PubChem CID 141341768) has the molecular formula C25H30N2O3S and a molecular weight of 438.59 g/mol. Its IUPAC name is N-[4-[2-methoxy-3-(1-methoxyheptyl)phenyl]-1,3-thiazol-2-yl]benzamide.
| Compound Name | N-[4-[2-methoxy-3-(1-methoxyheptyl)phenyl]-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 141341768 |
| Molecular Formula | C25H30N2O3S |
| Molecular Weight | 438.59 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | N-[4-[2-methoxy-3-(1-methoxyheptyl)phenyl]-1,3-thiazol-2-yl]benzamide |
| SMILES | CCCCCCC(OC)c1cccc(-c2csc(NC(=O)c3ccccc3)n2)c1OC |
| InChI | InChI=1S/C25H30N2O3S/c1-4-5-6-10-16-22(29-2)20-15-11-14-19(23(20)30-3)21-17-31-25(26-21)27-24(28)18-12-8-7-9-13-18/h7-9,11-15,17,22H,4-6,10,16H2,1-3H3,(H,26,27,28) |
| InChIKey | BNYXVRKIZWISGD-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.59 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|