C17H23NO2S — CID 141341770
4-[2-methoxy-3-(1-methoxyhexyl)phenyl]-1,3-thiazole (PubChem CID 141341770) has the molecular formula C17H23NO2S and a molecular weight of 305.44 g/mol. Its IUPAC name is 4-[2-methoxy-3-(1-methoxyhexyl)phenyl]-1,3-thiazole.
| Compound Name | 4-[2-methoxy-3-(1-methoxyhexyl)phenyl]-1,3-thiazole |
|---|---|
| PubChem CID | 141341770 |
| Molecular Formula | C17H23NO2S |
| Molecular Weight | 305.44 g/mol |
| Exact Mass | 305.14 |
| IUPAC Name | 4-[2-methoxy-3-(1-methoxyhexyl)phenyl]-1,3-thiazole |
| SMILES | CCCCCC(OC)c1cccc(-c2cscn2)c1OC |
| InChI | InChI=1S/C17H23NO2S/c1-4-5-6-10-16(19-2)14-9-7-8-13(17(14)20-3)15-11-21-12-18-15/h7-9,11-12,16H,4-6,10H2,1-3H3 |
| InChIKey | MFIKTLCMTBSYDZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.44 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|