C25H24F2N4O4 — CID 141346467
7-(3-amino-4-phenylmethoxyiminopiperidin-1-yl)-6-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid (PubChem CID 141346467) has the molecular formula C25H24F2N4O4 and a molecular weight of 482.49 g/mol. Its IUPAC name is 7-(3-amino-4-phenylmethoxyiminopiperidin-1-yl)-6-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid.
| Compound Name | 7-(3-amino-4-phenylmethoxyiminopiperidin-1-yl)-6-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid |
|---|---|
| PubChem CID | 141346467 |
| Molecular Formula | C25H24F2N4O4 |
| Molecular Weight | 482.49 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | 7-(3-amino-4-phenylmethoxyiminopiperidin-1-yl)-6-fluoro-1-[(1R,2S)-2-fluorocyclopropyl]-4-oxoquinoline-3-carboxylic acid |
| SMILES | NC1CN(c2cc3c(cc2F)c(=O)c(C(=O)O)cn3[C@@H]2C[C@@H]2F)CCC1=NOCc1ccccc1 |
| InChI | InChI=1S/C25H24F2N4O4/c26-17-8-15-21(31(23-9-18(23)27)11-16(24(15)32)25(33)34)10-22(17)30-7-6-20(19(28)12-30)29-35-13-14-4-2-1-3-5-14/h1-5,8,10-11,18-19,23H,6-7,9,12-13,28H2,(H,33,34)/t18-,19?,23+/m0/s1 |
| InChIKey | PMLMYKHRRIBRTQ-IZUFOGEXSA-N |
| XLogP | 3.23 |
| TPSA | 110.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.49 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|