C20H24O5 — CID 141346791
diethyl 2-ethoxy-4,6-dimethylazulene-1,3-dicarboxylate (PubChem CID 141346791) has the molecular formula C20H24O5 and a molecular weight of 344.41 g/mol. Its IUPAC name is diethyl 2-ethoxy-4,6-dimethylazulene-1,3-dicarboxylate.
| Compound Name | diethyl 2-ethoxy-4,6-dimethylazulene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 141346791 |
| Molecular Formula | C20H24O5 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.16 |
| IUPAC Name | diethyl 2-ethoxy-4,6-dimethylazulene-1,3-dicarboxylate |
| SMILES | CCOC(=O)c1c2ccc(C)cc(C)c-2c(C(=O)OCC)c1OCC |
| InChI | InChI=1S/C20H24O5/c1-6-23-18-16(19(21)24-7-2)14-10-9-12(4)11-13(5)15(14)17(18)20(22)25-8-3/h9-11H,6-8H2,1-5H3 |
| InChIKey | PXALRKXMCSDHIE-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |