C13H14F2O — CID 141351500
4-(3,4-difluorophenyl)-2,2-dimethylcyclopentan-1-one (PubChem CID 141351500) has the molecular formula C13H14F2O and a molecular weight of 224.25 g/mol. Its IUPAC name is 4-(3,4-difluorophenyl)-2,2-dimethylcyclopentan-1-one.
| Compound Name | 4-(3,4-difluorophenyl)-2,2-dimethylcyclopentan-1-one |
|---|---|
| PubChem CID | 141351500 |
| Molecular Formula | C13H14F2O |
| Molecular Weight | 224.25 g/mol |
| Exact Mass | 224.10 |
| IUPAC Name | 4-(3,4-difluorophenyl)-2,2-dimethylcyclopentan-1-one |
| SMILES | CC1(C)CC(c2ccc(F)c(F)c2)CC1=O |
| InChI | InChI=1S/C13H14F2O/c1-13(2)7-9(6-12(13)16)8-3-4-10(14)11(15)5-8/h3-5,9H,6-7H2,1-2H3 |
| InChIKey | CTNALXAQAPLBEG-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.25 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |