C11H13F2NO — CID 87297104
3-(3,4-difluorophenyl)-1-methyl-1-oxidopyrrolidin-1-ium (PubChem CID 87297104) has the molecular formula C11H13F2NO and a molecular weight of 213.23 g/mol. Its IUPAC name is 3-(3,4-difluorophenyl)-1-methyl-1-oxidopyrrolidin-1-ium.
| Compound Name | 3-(3,4-difluorophenyl)-1-methyl-1-oxidopyrrolidin-1-ium |
|---|---|
| PubChem CID | 87297104 |
| Molecular Formula | C11H13F2NO |
| Molecular Weight | 213.23 g/mol |
| Exact Mass | 213.10 |
| IUPAC Name | 3-(3,4-difluorophenyl)-1-methyl-1-oxidopyrrolidin-1-ium |
| SMILES | C[N+]1([O-])CCC(c2ccc(F)c(F)c2)C1 |
| InChI | InChI=1S/C11H13F2NO/c1-14(15)5-4-9(7-14)8-2-3-10(12)11(13)6-8/h2-3,6,9H,4-5,7H2,1H3 |
| InChIKey | YCSKANWUGKJYLM-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 23.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.23 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|