C14H10O2S — CID 141358096
1-phenyl-2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)ethane-1,2-dione (PubChem CID 141358096) has the molecular formula C14H10O2S and a molecular weight of 242.30 g/mol. Its IUPAC name is 1-phenyl-2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)ethane-1,2-dione.
| Compound Name | 1-phenyl-2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)ethane-1,2-dione |
|---|---|
| PubChem CID | 141358096 |
| Molecular Formula | C14H10O2S |
| Molecular Weight | 242.30 g/mol |
| Exact Mass | 242.04 |
| IUPAC Name | 1-phenyl-2-(6-sulfanylidenecyclohexa-2,4-dien-1-yl)ethane-1,2-dione |
| SMILES | O=C(C(=O)C1C=CC=CC1=S)c1ccccc1 |
| InChI | InChI=1S/C14H10O2S/c15-13(10-6-2-1-3-7-10)14(16)11-8-4-5-9-12(11)17/h1-9,11H |
| InChIKey | BJHACCKMVZAKOU-UHFFFAOYSA-N |
| XLogP | 2.55 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.30 |
| LogP ≤ 5 | 2.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|