C30H56N2O4 — CID 141358512
2-[2-[6-[9-(2,6,6-trimethylcyclohexen-1-yl)nonylamino]hexylamino]ethoxy]ethyl 2-oxoacetate (PubChem CID 141358512) has the molecular formula C30H56N2O4 and a molecular weight of 508.79 g/mol. Its IUPAC name is 2-[2-[6-[9-(2,6,6-trimethylcyclohexen-1-yl)nonylamino]hexylamino]ethoxy]ethyl 2-oxoacetate.
| Compound Name | 2-[2-[6-[9-(2,6,6-trimethylcyclohexen-1-yl)nonylamino]hexylamino]ethoxy]ethyl 2-oxoacetate |
|---|---|
| PubChem CID | 141358512 |
| Molecular Formula | C30H56N2O4 |
| Molecular Weight | 508.79 g/mol |
| Exact Mass | 508.42 |
| IUPAC Name | 2-[2-[6-[9-(2,6,6-trimethylcyclohexen-1-yl)nonylamino]hexylamino]ethoxy]ethyl 2-oxoacetate |
| SMILES | CC1=C(CCCCCCCCCNCCCCCCNCCOCCOC(=O)C=O)C(C)(C)CCC1 |
| InChI | InChI=1S/C30H56N2O4/c1-27-16-15-18-30(2,3)28(27)17-11-7-5-4-6-8-12-19-31-20-13-9-10-14-21-32-22-23-35-24-25-36-29(34)26-33/h26,31-32H,4-25H2,1-3H3 |
| InChIKey | RTSKNMRIBKHLKC-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.79 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|