C27H34N6O12 — CID 14135913
methyl (2S)-4-[3-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-4,6-dimethyl-9-oxoimidazo[1,2-a]purin-7-yl]-2-(methoxycarbonylamino)butanoate (PubChem CID 14135913) has the molecular formula C27H34N6O12 and a molecular weight of 634.60 g/mol. Its IUPAC name is methyl (2S)-4-[3-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-4,6-dimethyl-9-oxoimidazo[1,2-a]purin-7-yl]-2-(methoxycarbonylamino)butanoate.
| Compound Name | methyl (2S)-4-[3-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-4,6-dimethyl-9-oxoimidazo[1,2-a]purin-7-yl]-2-(methoxycarbonylamino)butanoate |
|---|---|
| PubChem CID | 14135913 |
| Molecular Formula | C27H34N6O12 |
| Molecular Weight | 634.60 g/mol |
| Exact Mass | 634.22 |
| IUPAC Name | methyl (2S)-4-[3-[(2R,3R,4R,5R)-3,4-diacetyloxy-5-(acetyloxymethyl)oxolan-2-yl]-4,6-dimethyl-9-oxoimidazo[1,2-a]purin-7-yl]-2-(methoxycarbonylamino)butanoate |
| SMILES | COC(=O)N[C@@H](CCc1c(C)nc2n(C)c3c(ncn3[C@@H]3O[C@H](COC(C)=O)[C@@H](OC(C)=O)[C@H]3OC(C)=O)c(=O)n12)C(=O)OC |
| InChI | InChI=1S/C27H34N6O12/c1-12-17(9-8-16(25(38)40-6)30-27(39)41-7)33-23(37)19-22(31(5)26(33)29-12)32(11-28-19)24-21(44-15(4)36)20(43-14(3)35)18(45-24)10-42-13(2)34/h11,16,18,20-21,24H,8-10H2,1-7H3,(H,30,39)/t16-,18+,20+,21+,24+/m0/s1 |
| InChIKey | IRVHQUPYQGKZOV-RJGKEJCXSA-N |
| XLogP | -0.15 |
| TPSA | 209.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 634.60 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|