C14H31NOSi — CID 141382048
(2S)-1-[2,2-dimethylpropyl(dimethyl)silyl]oxy-3-ethylpent-3-en-2-amine (PubChem CID 141382048) has the molecular formula C14H31NOSi and a molecular weight of 257.49 g/mol. Its IUPAC name is (2S)-1-[2,2-dimethylpropyl(dimethyl)silyl]oxy-3-ethylpent-3-en-2-amine.
| Compound Name | (2S)-1-[2,2-dimethylpropyl(dimethyl)silyl]oxy-3-ethylpent-3-en-2-amine |
|---|---|
| PubChem CID | 141382048 |
| Molecular Formula | C14H31NOSi |
| Molecular Weight | 257.49 g/mol |
| Exact Mass | 257.22 |
| IUPAC Name | (2S)-1-[2,2-dimethylpropyl(dimethyl)silyl]oxy-3-ethylpent-3-en-2-amine |
| SMILES | CC=C(CC)[C@H](N)CO[Si](C)(C)CC(C)(C)C |
| InChI | InChI=1S/C14H31NOSi/c1-8-12(9-2)13(15)10-16-17(6,7)11-14(3,4)5/h8,13H,9-11,15H2,1-7H3/t13-/m1/s1 |
| InChIKey | DWQBCFYAOWOZRK-CYBMUJFWSA-N |
| XLogP | 3.94 |
| TPSA | 35.25 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.49 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|