C16H31NO4Si — CID 141382082
6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 141382082) has the molecular formula C16H31NO4Si and a molecular weight of 329.51 g/mol. Its IUPAC name is 6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 141382082 |
| Molecular Formula | C16H31NO4Si |
| Molecular Weight | 329.51 g/mol |
| Exact Mass | 329.20 |
| IUPAC Name | 6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-4,5-dimethyl-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | CC1=C(C)C(CO[Si](C)(C)CC(C)(C)C)N(C(=O)O)CC1O |
| InChI | InChI=1S/C16H31NO4Si/c1-11-12(2)14(18)8-17(15(19)20)13(11)9-21-22(6,7)10-16(3,4)5/h13-14,18H,8-10H2,1-7H3,(H,19,20) |
| InChIKey | DXANTBISTMNJIU-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.51 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|