C17H33NO4Si — CID 141382088
6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 141382088) has the molecular formula C17H33NO4Si and a molecular weight of 343.54 g/mol. Its IUPAC name is 6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 141382088 |
| Molecular Formula | C17H33NO4Si |
| Molecular Weight | 343.54 g/mol |
| Exact Mass | 343.22 |
| IUPAC Name | 6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-5-propan-2-yl-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | CC(C)C1=CC(O)CN(C(=O)O)C1CO[Si](C)(C)CC(C)(C)C |
| InChI | InChI=1S/C17H33NO4Si/c1-12(2)14-8-13(19)9-18(16(20)21)15(14)10-22-23(6,7)11-17(3,4)5/h8,12-13,15,19H,9-11H2,1-7H3,(H,20,21) |
| InChIKey | ZWRXFLHWWGEMPF-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.54 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|