C17H31NO4Si — CID 141382087
5-cyclopropyl-6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylic acid (PubChem CID 141382087) has the molecular formula C17H31NO4Si and a molecular weight of 341.52 g/mol. Its IUPAC name is 5-cyclopropyl-6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylic acid.
| Compound Name | 5-cyclopropyl-6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylic acid |
|---|---|
| PubChem CID | 141382087 |
| Molecular Formula | C17H31NO4Si |
| Molecular Weight | 341.52 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 5-cyclopropyl-6-[[2,2-dimethylpropyl(dimethyl)silyl]oxymethyl]-3-hydroxy-3,6-dihydro-2H-pyridine-1-carboxylic acid |
| SMILES | CC(C)(C)C[Si](C)(C)OCC1C(C2CC2)=CC(O)CN1C(=O)O |
| InChI | InChI=1S/C17H31NO4Si/c1-17(2,3)11-23(4,5)22-10-15-14(12-6-7-12)8-13(19)9-18(15)16(20)21/h8,12-13,15,19H,6-7,9-11H2,1-5H3,(H,20,21) |
| InChIKey | GKUVMHWPDRNXJK-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.52 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|