C9H10IN3O2 — CID 141392738
2-(5-iodo-2-nitro-3-pyridinyl)-N,N-dimethylethenamine (PubChem CID 141392738) has the molecular formula C9H10IN3O2 and a molecular weight of 319.10 g/mol. Its IUPAC name is 2-(5-iodo-2-nitro-3-pyridinyl)-N,N-dimethylethenamine.
| Compound Name | 2-(5-iodo-2-nitro-3-pyridinyl)-N,N-dimethylethenamine |
|---|---|
| PubChem CID | 141392738 |
| Molecular Formula | C9H10IN3O2 |
| Molecular Weight | 319.10 g/mol |
| Exact Mass | 318.98 |
| IUPAC Name | 2-(5-iodo-2-nitro-3-pyridinyl)-N,N-dimethylethenamine |
| SMILES | CN(C)C=Cc1cc(I)cnc1[N+](=O)[O-] |
| InChI | InChI=1S/C9H10IN3O2/c1-12(2)4-3-7-5-8(10)6-11-9(7)13(14)15/h3-6H,1-2H3 |
| InChIKey | UCIRICQUAOUKRB-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 59.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.10 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|