C40H64N2O4 — CID 141394776
2,9-bis[(3,5-dibutyl-4-hydroxyphenyl)methyl]decanediamide (PubChem CID 141394776) has the molecular formula C40H64N2O4 and a molecular weight of 636.96 g/mol. Its IUPAC name is 2,9-bis[(3,5-dibutyl-4-hydroxyphenyl)methyl]decanediamide.
| Compound Name | 2,9-bis[(3,5-dibutyl-4-hydroxyphenyl)methyl]decanediamide |
|---|---|
| PubChem CID | 141394776 |
| Molecular Formula | C40H64N2O4 |
| Molecular Weight | 636.96 g/mol |
| Exact Mass | 636.49 |
| IUPAC Name | 2,9-bis[(3,5-dibutyl-4-hydroxyphenyl)methyl]decanediamide |
| SMILES | CCCCc1cc(CC(CCCCCCC(Cc2cc(CCCC)c(O)c(CCCC)c2)C(N)=O)C(N)=O)cc(CCCC)c1O |
| InChI | InChI=1S/C40H64N2O4/c1-5-9-17-31-23-29(24-32(37(31)43)18-10-6-2)27-35(39(41)45)21-15-13-14-16-22-36(40(42)46)28-30-25-33(19-11-7-3)38(44)34(26-30)20-12-8-4/h23-26,35-36,43-44H,5-22,27-28H2,1-4H3,(H2,41,45)(H2,42,46) |
| InChIKey | WDGDTWVLGCCAAS-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 126.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 25 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 636.96 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|