C20H24ClN3O2 — CID 141421194
N-[4-(2-amino-2-ethylcyclopropyl)phenyl]-2-chloro-4-(1-hydroxyethylamino)benzamide (PubChem CID 141421194) has the molecular formula C20H24ClN3O2 and a molecular weight of 373.88 g/mol. Its IUPAC name is N-[4-(2-amino-2-ethylcyclopropyl)phenyl]-2-chloro-4-(1-hydroxyethylamino)benzamide.
| Compound Name | N-[4-(2-amino-2-ethylcyclopropyl)phenyl]-2-chloro-4-(1-hydroxyethylamino)benzamide |
|---|---|
| PubChem CID | 141421194 |
| Molecular Formula | C20H24ClN3O2 |
| Molecular Weight | 373.88 g/mol |
| Exact Mass | 373.16 |
| IUPAC Name | N-[4-(2-amino-2-ethylcyclopropyl)phenyl]-2-chloro-4-(1-hydroxyethylamino)benzamide |
| SMILES | CCC1(N)CC1c1ccc(NC(=O)c2ccc(NC(C)O)cc2Cl)cc1 |
| InChI | InChI=1S/C20H24ClN3O2/c1-3-20(22)11-17(20)13-4-6-14(7-5-13)24-19(26)16-9-8-15(10-18(16)21)23-12(2)25/h4-10,12,17,23,25H,3,11,22H2,1-2H3,(H,24,26) |
| InChIKey | YCDNKYVAGPFSLU-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 87.38 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.88 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|