C17H11Cl3F3N — CID 141437572
5-phenyl-3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrole (PubChem CID 141437572) has the molecular formula C17H11Cl3F3N and a molecular weight of 392.64 g/mol. Its IUPAC name is 5-phenyl-3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrole.
| Compound Name | 5-phenyl-3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrole |
|---|---|
| PubChem CID | 141437572 |
| Molecular Formula | C17H11Cl3F3N |
| Molecular Weight | 392.64 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | 5-phenyl-3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrole |
| SMILES | FC(F)(F)C1(c2cc(Cl)c(Cl)c(Cl)c2)CN=C(c2ccccc2)C1 |
| InChI | InChI=1S/C17H11Cl3F3N/c18-12-6-11(7-13(19)15(12)20)16(17(21,22)23)8-14(24-9-16)10-4-2-1-3-5-10/h1-7H,8-9H2 |
| InChIKey | IWZQAXZSIUZEPX-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.64 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|