C17H13Cl3F3N3 — CID 87424545
[4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]phenyl]hydrazine (PubChem CID 87424545) has the molecular formula C17H13Cl3F3N3 and a molecular weight of 422.67 g/mol. Its IUPAC name is [4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]phenyl]hydrazine.
| Compound Name | [4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]phenyl]hydrazine |
|---|---|
| PubChem CID | 87424545 |
| Molecular Formula | C17H13Cl3F3N3 |
| Molecular Weight | 422.67 g/mol |
| Exact Mass | 421.01 |
| IUPAC Name | [4-[3-(3,4,5-trichlorophenyl)-3-(trifluoromethyl)-2,4-dihydropyrrol-5-yl]phenyl]hydrazine |
| SMILES | NNc1ccc(C2=NCC(c3cc(Cl)c(Cl)c(Cl)c3)(C(F)(F)F)C2)cc1 |
| InChI | InChI=1S/C17H13Cl3F3N3/c18-12-5-10(6-13(19)15(12)20)16(17(21,22)23)7-14(25-8-16)9-1-3-11(26-24)4-2-9/h1-6,26H,7-8,24H2 |
| InChIKey | QGAOTVSVZOIRPX-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.67 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|