C14H15N — CID 141443108
4,4,7-trimethyl-1H-indeno[1,2-b]pyrrole (PubChem CID 141443108) has the molecular formula C14H15N and a molecular weight of 197.28 g/mol. Its IUPAC name is 4,4,7-trimethyl-1H-indeno[1,2-b]pyrrole.
| Compound Name | 4,4,7-trimethyl-1H-indeno[1,2-b]pyrrole |
|---|---|
| PubChem CID | 141443108 |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.28 g/mol |
| Exact Mass | 197.12 |
| IUPAC Name | 4,4,7-trimethyl-1H-indeno[1,2-b]pyrrole |
| SMILES | Cc1ccc2c(c1)-c1[nH]ccc1C2(C)C |
| InChI | InChI=1S/C14H15N/c1-9-4-5-11-10(8-9)13-12(6-7-15-13)14(11,2)3/h4-8,15H,1-3H3 |
| InChIKey | GAEMYVBJAUAJEK-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 15.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.28 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |