C16H24O2 — CID 141455417
3-[(3,5-dimethyl-1-adamantyl)oxy]but-3-en-2-one (PubChem CID 141455417) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is 3-[(3,5-dimethyl-1-adamantyl)oxy]but-3-en-2-one.
| Compound Name | 3-[(3,5-dimethyl-1-adamantyl)oxy]but-3-en-2-one |
|---|---|
| PubChem CID | 141455417 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | 3-[(3,5-dimethyl-1-adamantyl)oxy]but-3-en-2-one |
| SMILES | C=C(OC12CC3CC(C)(CC(C)(C3)C1)C2)C(C)=O |
| InChI | InChI=1S/C16H24O2/c1-11(17)12(2)18-16-7-13-5-14(3,9-16)8-15(4,6-13)10-16/h13H,2,5-10H2,1,3-4H3 |
| InChIKey | JZHBJRDAXUHTTG-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|