C23H25N5O4 — CID 141463657
N-hydroxy-4-[4-(3-methylanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypentanamide (PubChem CID 141463657) has the molecular formula C23H25N5O4 and a molecular weight of 435.48 g/mol. Its IUPAC name is N-hydroxy-4-[4-(3-methylanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypentanamide.
| Compound Name | N-hydroxy-4-[4-(3-methylanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypentanamide |
|---|---|
| PubChem CID | 141463657 |
| Molecular Formula | C23H25N5O4 |
| Molecular Weight | 435.48 g/mol |
| Exact Mass | 435.19 |
| IUPAC Name | N-hydroxy-4-[4-(3-methylanilino)-6-(prop-2-enoylamino)quinazolin-7-yl]oxypentanamide |
| SMILES | C=CC(=O)Nc1cc2c(Nc3cccc(C)c3)ncnc2cc1OC(C)CCC(=O)NO |
| InChI | InChI=1S/C23H25N5O4/c1-4-21(29)27-19-11-17-18(12-20(19)32-15(3)8-9-22(30)28-31)24-13-25-23(17)26-16-7-5-6-14(2)10-16/h4-7,10-13,15,31H,1,8-9H2,2-3H3,(H,27,29)(H,28,30)(H,24,25,26) |
| InChIKey | DLVMXMYXJZUGMZ-UHFFFAOYSA-N |
| XLogP | 3.86 |
| TPSA | 125.47 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.48 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|