About ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne
ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne (PubChem CID 141465548) has the molecular formula C7H9FO4
and a molecular weight of 176.14 g/mol. Its IUPAC name is ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne.
Molecular Properties
| Compound Name | ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne |
| PubChem CID | 141465548 |
| Molecular Formula | C7H9FO4 |
| Molecular Weight | 176.14 g/mol |
| Exact Mass | 176.05 |
| IUPAC Name | ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne |
| SMILES | C#CC.CCOOC(=O)C(=O)F |
| InChI | InChI=1S/C4H5FO4.C3H4/c1-2-8-9-4(7)3(5)6;1-3-2/h2H2,1H3;1H,2H3 |
| InChIKey | VUSPABPTLINWED-UHFFFAOYSA-N |
| XLogP | 0.62 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.14 |
| LogP ≤ 5 | 0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne?
The IUPAC name of ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne (CID 141465548) is ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne.
What is the SMILES notation for ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne?
The canonical SMILES for ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne is C#CC.CCOOC(=O)C(=O)F.
What is the InChIKey of ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne?
The InChIKey is VUSPABPTLINWED-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H5FO4.C3H4/c1-2-8-9-4(7)3(5)6;1-3-2/h2H2,1H3;1H,2H3.
What are the key properties of ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne?
ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne has a molecular weight of 176.14 g/mol, XLogP of 0.62, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-fluoro-2-oxoethaneperoxoate;prop-1-yne is sourced from PubChem (CID 141465548), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).