C29H50O2 — CID 141468621
(2S)-3,3,4,4-tetradeuterio-2-[(4R,8S)-1,1-dideuterio-4,8,12-trimethyltridecyl]-2,5,7,8-tetramethylchromen-6-ol (PubChem CID 141468621) has the molecular formula C29H50O2 and a molecular weight of 436.75 g/mol. Its IUPAC name is (2S)-3,3,4,4-tetradeuterio-2-[(4R,8S)-1,1-dideuterio-4,8,12-trimethyltridecyl]-2,5,7,8-tetramethylchromen-6-ol.
| Compound Name | (2S)-3,3,4,4-tetradeuterio-2-[(4R,8S)-1,1-dideuterio-4,8,12-trimethyltridecyl]-2,5,7,8-tetramethylchromen-6-ol |
|---|---|
| PubChem CID | 141468621 |
| Molecular Formula | C29H50O2 |
| Molecular Weight | 436.75 g/mol |
| Exact Mass | 436.42 |
| IUPAC Name | (2S)-3,3,4,4-tetradeuterio-2-[(4R,8S)-1,1-dideuterio-4,8,12-trimethyltridecyl]-2,5,7,8-tetramethylchromen-6-ol |
| SMILES | [2H]C1([2H])c2c(C)c(O)c(C)c(C)c2O[C@@](C)(C([2H])([2H])CC[C@H](C)CCC[C@@H](C)CCCC(C)C)C1([2H])[2H] |
| InChI | InChI=1S/C29H50O2/c1-20(2)12-9-13-21(3)14-10-15-22(4)16-11-18-29(8)19-17-26-25(7)27(30)23(5)24(6)28(26)31-29/h20-22,30H,9-19H2,1-8H3/t21-,22+,29-/m0/s1/i17D2,18D2,19D2 |
| InChIKey | GVJHHUAWPYXKBD-POQFCDALSA-N |
| XLogP | 8.84 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.75 |
| LogP ≤ 5 | 8.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |