C10H8Br3NO — CID 141489113
N-[(2,4,6-tribromophenyl)methyl]prop-2-enamide (PubChem CID 141489113) has the molecular formula C10H8Br3NO and a molecular weight of 397.89 g/mol. Its IUPAC name is N-[(2,4,6-tribromophenyl)methyl]prop-2-enamide.
| Compound Name | N-[(2,4,6-tribromophenyl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 141489113 |
| Molecular Formula | C10H8Br3NO |
| Molecular Weight | 397.89 g/mol |
| Exact Mass | 394.82 |
| IUPAC Name | N-[(2,4,6-tribromophenyl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1c(Br)cc(Br)cc1Br |
| InChI | InChI=1S/C10H8Br3NO/c1-2-10(15)14-5-7-8(12)3-6(11)4-9(7)13/h2-4H,1,5H2,(H,14,15) |
| InChIKey | RHGQXDCPQNSTJB-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.89 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|