C8H10N2OS — CID 166405845
N-[(3-methyl-1,2-thiazol-5-yl)methyl]prop-2-enamide (PubChem CID 166405845) has the molecular formula C8H10N2OS and a molecular weight of 182.25 g/mol. Its IUPAC name is N-[(3-methyl-1,2-thiazol-5-yl)methyl]prop-2-enamide.
| Compound Name | N-[(3-methyl-1,2-thiazol-5-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 166405845 |
| Molecular Formula | C8H10N2OS |
| Molecular Weight | 182.25 g/mol |
| Exact Mass | 182.05 |
| IUPAC Name | N-[(3-methyl-1,2-thiazol-5-yl)methyl]prop-2-enamide |
| SMILES | C=CC(=O)NCc1cc(C)ns1 |
| InChI | InChI=1S/C8H10N2OS/c1-3-8(11)9-5-7-4-6(2)10-12-7/h3-4H,1,5H2,2H3,(H,9,11) |
| InChIKey | KMYNVEJSICHFKW-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|