C20H31BN4O2 — CID 141489392
1-methyl-3-(2-piperazin-1-ylethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole (PubChem CID 141489392) has the molecular formula C20H31BN4O2 and a molecular weight of 370.31 g/mol. Its IUPAC name is 1-methyl-3-(2-piperazin-1-ylethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole.
| Compound Name | 1-methyl-3-(2-piperazin-1-ylethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
|---|---|
| PubChem CID | 141489392 |
| Molecular Formula | C20H31BN4O2 |
| Molecular Weight | 370.31 g/mol |
| Exact Mass | 370.25 |
| IUPAC Name | 1-methyl-3-(2-piperazin-1-ylethyl)-6-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indazole |
| SMILES | Cn1nc(CCN2CCNCC2)c2ccc(B3OC(C)(C)C(C)(C)O3)cc21 |
| InChI | InChI=1S/C20H31BN4O2/c1-19(2)20(3,4)27-21(26-19)15-6-7-16-17(23-24(5)18(16)14-15)8-11-25-12-9-22-10-13-25/h6-7,14,22H,8-13H2,1-5H3 |
| InChIKey | AEMVZBXQTJMKFX-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 51.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.31 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|